C22H27Cl2FN2OS — CID 170580201
(3R)-1-buta-1,3-dien-2-ylsulfanyl-N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]pyrrolidine-3-carboxamide (PubChem CID 170580201) has the molecular formula C22H27Cl2FN2OS and a molecular weight of 457.44 g/mol. Its IUPAC name is (3R)-1-buta-1,3-dien-2-ylsulfanyl-N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-buta-1,3-dien-2-ylsulfanyl-N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 170580201 |
| Molecular Formula | C22H27Cl2FN2OS |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (3R)-1-buta-1,3-dien-2-ylsulfanyl-N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]pyrrolidine-3-carboxamide |
| SMILES | C=CC(=C)SN1CC[C@@H](C(=O)NC(c2c(F)ccc(Cl)c2Cl)C2(C)CCCC2)C1 |
| InChI | InChI=1S/C22H27Cl2FN2OS/c1-4-14(2)29-27-12-9-15(13-27)21(28)26-20(22(3)10-5-6-11-22)18-17(25)8-7-16(23)19(18)24/h4,7-8,15,20H,1-2,5-6,9-13H2,3H3,(H,26,28)/t15-,20?/m1/s1 |
| InChIKey | HPPKYAPCKQKUQU-IWPPFLRJSA-N |
| XLogP | 6.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|