C21H28ClFN4O2 — CID 170578765
3-N-[(2-chloro-6-fluoro-3-methylphenyl)-(1-methylcyclopentyl)methyl]-6-iminopiperidine-1,3-dicarboxamide (PubChem CID 170578765) has the molecular formula C21H28ClFN4O2 and a molecular weight of 422.93 g/mol. Its IUPAC name is 3-N-[(2-chloro-6-fluoro-3-methylphenyl)-(1-methylcyclopentyl)methyl]-6-iminopiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[(2-chloro-6-fluoro-3-methylphenyl)-(1-methylcyclopentyl)methyl]-6-iminopiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 170578765 |
| Molecular Formula | C21H28ClFN4O2 |
| Molecular Weight | 422.93 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 3-N-[(2-chloro-6-fluoro-3-methylphenyl)-(1-methylcyclopentyl)methyl]-6-iminopiperidine-1,3-dicarboxamide |
| SMILES | [H]/N=C1\CCC(C(=O)NC(c2c(F)ccc(C)c2Cl)C2(C)CCCC2)CN1C(N)=O |
| InChI | InChI=1S/C21H28ClFN4O2/c1-12-5-7-14(23)16(17(12)22)18(21(2)9-3-4-10-21)26-19(28)13-6-8-15(24)27(11-13)20(25)29/h5,7,13,18,24H,3-4,6,8-11H2,1-2H3,(H2,25,29)(H,26,28)/b24-15+ |
| InChIKey | DDFGAFDXXUGWAS-BUVRLJJBSA-N |
| XLogP | 4.29 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|