C27H30Cl2FN3O3 — CID 170580766
(5R)-1-benzyl-N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-2,8-dioxo-1,3-diazocane-5-carboxamide (PubChem CID 170580766) has the molecular formula C27H30Cl2FN3O3 and a molecular weight of 534.46 g/mol. Its IUPAC name is (5R)-1-benzyl-N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-2,8-dioxo-1,3-diazocane-5-carboxamide.
| Compound Name | (5R)-1-benzyl-N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-2,8-dioxo-1,3-diazocane-5-carboxamide |
|---|---|
| PubChem CID | 170580766 |
| Molecular Formula | C27H30Cl2FN3O3 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | (5R)-1-benzyl-N-[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]-2,8-dioxo-1,3-diazocane-5-carboxamide |
| SMILES | CC1([C@H](NC(=O)[C@@H]2CCC(=O)N(Cc3ccccc3)C(=O)NC2)c2c(F)ccc(Cl)c2Cl)CCCC1 |
| InChI | InChI=1S/C27H30Cl2FN3O3/c1-27(13-5-6-14-27)24(22-20(30)11-10-19(28)23(22)29)32-25(35)18-9-12-21(34)33(26(36)31-15-18)16-17-7-3-2-4-8-17/h2-4,7-8,10-11,18,24H,5-6,9,12-16H2,1H3,(H,31,36)(H,32,35)/t18-,24-/m1/s1 |
| InChIKey | HFWFYUJLBUNTSH-HOYKHHGWSA-N |
| XLogP | 6.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|