C27H32Cl2FN2O2Sb — CID 170580865
CID 170580865 (PubChem CID 170580865) has the molecular formula C27H32Cl2FN2O2Sb and a molecular weight of 628.23 g/mol.
| Compound Name | CID 170580865 |
|---|---|
| PubChem CID | 170580865 |
| Molecular Formula | C27H32Cl2FN2O2Sb |
| Molecular Weight | 628.23 g/mol |
| Exact Mass | 626.09 |
| IUPAC Name | — |
| SMILES | CC1(C(NC(=O)C2CC(NC(=O)Cc3ccccc3)C2)c2c(F)ccc(Cl)c2Cl)CCCC1.C[Sb] |
| InChI | InChI=1S/C26H29Cl2FN2O2.CH3.Sb/c1-26(11-5-6-12-26)24(22-20(29)10-9-19(27)23(22)28)31-25(33)17-14-18(15-17)30-21(32)13-16-7-3-2-4-8-16;;/h2-4,7-10,17-18,24H,5-6,11-15H2,1H3,(H,30,32)(H,31,33);1H3; |
| InChIKey | CPBNMGNRRHARMY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.23 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|