C25H37Cl2FN2O2 — CID 170581301
N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentanecarboxamide;4-methylpentanamide (PubChem CID 170581301) has the molecular formula C25H37Cl2FN2O2 and a molecular weight of 487.49 g/mol. Its IUPAC name is N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentanecarboxamide;4-methylpentanamide.
| Compound Name | N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentanecarboxamide;4-methylpentanamide |
|---|---|
| PubChem CID | 170581301 |
| Molecular Formula | C25H37Cl2FN2O2 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | N-[(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]cyclopentanecarboxamide;4-methylpentanamide |
| SMILES | CC(C)CCC(N)=O.CC1(C(NC(=O)C2CCCC2)c2c(F)ccc(Cl)c2Cl)CCCC1 |
| InChI | InChI=1S/C19H24Cl2FNO.C6H13NO/c1-19(10-4-5-11-19)17(23-18(24)12-6-2-3-7-12)15-14(22)9-8-13(20)16(15)21;1-5(2)3-4-6(7)8/h8-9,12,17H,2-7,10-11H2,1H3,(H,23,24);5H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | BWOJPPIBJQAFTB-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|