C23H29Cl2FN2O3 — CID 170580644
N-[(1R,3R)-3-[[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]carbamoyl]cyclopentyl]oxetane-3-carboxamide (PubChem CID 170580644) has the molecular formula C23H29Cl2FN2O3 and a molecular weight of 471.40 g/mol. Its IUPAC name is N-[(1R,3R)-3-[[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]carbamoyl]cyclopentyl]oxetane-3-carboxamide.
| Compound Name | N-[(1R,3R)-3-[[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]carbamoyl]cyclopentyl]oxetane-3-carboxamide |
|---|---|
| PubChem CID | 170580644 |
| Molecular Formula | C23H29Cl2FN2O3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[(1R,3R)-3-[[(S)-(2,3-dichloro-6-fluorophenyl)-(1-methylcyclopentyl)methyl]carbamoyl]cyclopentyl]oxetane-3-carboxamide |
| SMILES | CC1([C@H](NC(=O)[C@@H]2CC[C@@H](NC(=O)C3COC3)C2)c2c(F)ccc(Cl)c2Cl)CCCC1 |
| InChI | InChI=1S/C23H29Cl2FN2O3/c1-23(8-2-3-9-23)20(18-17(26)7-6-16(24)19(18)25)28-21(29)13-4-5-15(10-13)27-22(30)14-11-31-12-14/h6-7,13-15,20H,2-5,8-12H2,1H3,(H,27,30)(H,28,29)/t13-,15-,20-/m1/s1 |
| InChIKey | NTJQUFKHXPTINM-WAWZGNHOSA-N |
| XLogP | 4.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|