C22H25ClF4N2O3 — CID 170579356
(1S,3S,4R)-3-acetamido-N-[(S)-(3-chloro-2,6-difluorophenyl)-[(1S,5R)-6,6-difluoro-3-methyl-3-bicyclo[3.1.0]hexanyl]methyl]-4-hydroxycyclopentane-1-carboxamide (PubChem CID 170579356) has the molecular formula C22H25ClF4N2O3 and a molecular weight of 476.90 g/mol. Its IUPAC name is (1S,3S,4R)-3-acetamido-N-[(S)-(3-chloro-2,6-difluorophenyl)-[(1S,5R)-6,6-difluoro-3-methyl-3-bicyclo[3.1.0]hexanyl]methyl]-4-hydroxycyclopentane-1-carboxamide.
| Compound Name | (1S,3S,4R)-3-acetamido-N-[(S)-(3-chloro-2,6-difluorophenyl)-[(1S,5R)-6,6-difluoro-3-methyl-3-bicyclo[3.1.0]hexanyl]methyl]-4-hydroxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 170579356 |
| Molecular Formula | C22H25ClF4N2O3 |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | (1S,3S,4R)-3-acetamido-N-[(S)-(3-chloro-2,6-difluorophenyl)-[(1S,5R)-6,6-difluoro-3-methyl-3-bicyclo[3.1.0]hexanyl]methyl]-4-hydroxycyclopentane-1-carboxamide |
| SMILES | CC(=O)N[C@H]1C[C@H](C(=O)N[C@H](c2c(F)ccc(Cl)c2F)C2(C)C[C@@H]3[C@H](C2)C3(F)F)C[C@H]1O |
| InChI | InChI=1S/C22H25ClF4N2O3/c1-9(30)28-15-5-10(6-16(15)31)20(32)29-19(17-14(24)4-3-13(23)18(17)25)21(2)7-11-12(8-21)22(11,26)27/h3-4,10-12,15-16,19,31H,5-8H2,1-2H3,(H,28,30)(H,29,32)/t10-,11-,12+,15-,16+,19+,21?/m0/s1 |
| InChIKey | TUXSDPVVDNEEHF-JLNRNIOJSA-N |
| XLogP | 3.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|