C23H27ClF2N2O2 — CID 170578622
(1R)-3-acetamido-N-[(S)-1-bicyclo[2.2.2]oct-3-enyl-(3-chloro-2,6-difluorophenyl)methyl]cyclopentane-1-carboxamide (PubChem CID 170578622) has the molecular formula C23H27ClF2N2O2 and a molecular weight of 436.93 g/mol. Its IUPAC name is (1R)-3-acetamido-N-[(S)-1-bicyclo[2.2.2]oct-3-enyl-(3-chloro-2,6-difluorophenyl)methyl]cyclopentane-1-carboxamide.
| Compound Name | (1R)-3-acetamido-N-[(S)-1-bicyclo[2.2.2]oct-3-enyl-(3-chloro-2,6-difluorophenyl)methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 170578622 |
| Molecular Formula | C23H27ClF2N2O2 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (1R)-3-acetamido-N-[(S)-1-bicyclo[2.2.2]oct-3-enyl-(3-chloro-2,6-difluorophenyl)methyl]cyclopentane-1-carboxamide |
| SMILES | CC(=O)NC1CC[C@@H](C(=O)N[C@H](c2c(F)ccc(Cl)c2F)C23CC=C(CC2)CC3)C1 |
| InChI | InChI=1S/C23H27ClF2N2O2/c1-13(29)27-16-3-2-15(12-16)22(30)28-21(19-18(25)5-4-17(24)20(19)26)23-9-6-14(7-10-23)8-11-23/h4-6,15-16,21H,2-3,7-12H2,1H3,(H,27,29)(H,28,30)/t15-,16?,21-/m1/s1 |
| InChIKey | PWJATMAAIIVPOM-VRTSCDAPSA-N |
| XLogP | 4.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|