C22H26ClF3N2O2 — CID 175988271
(2S)-N-[(1S,3S)-3-acetamidocyclopentyl]-2-(3-chloro-2,6-difluorophenyl)-2-(4-fluoro-1-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 175988271) has the molecular formula C22H26ClF3N2O2 and a molecular weight of 442.91 g/mol. Its IUPAC name is (2S)-N-[(1S,3S)-3-acetamidocyclopentyl]-2-(3-chloro-2,6-difluorophenyl)-2-(4-fluoro-1-bicyclo[2.2.1]heptanyl)acetamide.
| Compound Name | (2S)-N-[(1S,3S)-3-acetamidocyclopentyl]-2-(3-chloro-2,6-difluorophenyl)-2-(4-fluoro-1-bicyclo[2.2.1]heptanyl)acetamide |
|---|---|
| PubChem CID | 175988271 |
| Molecular Formula | C22H26ClF3N2O2 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (2S)-N-[(1S,3S)-3-acetamidocyclopentyl]-2-(3-chloro-2,6-difluorophenyl)-2-(4-fluoro-1-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | CC(=O)N[C@H]1CC[C@H](NC(=O)[C@H](c2c(F)ccc(Cl)c2F)C23CCC(F)(CC2)C3)C1 |
| InChI | InChI=1S/C22H26ClF3N2O2/c1-12(29)27-13-2-3-14(10-13)28-20(30)18(17-16(24)5-4-15(23)19(17)25)21-6-8-22(26,11-21)9-7-21/h4-5,13-14,18H,2-3,6-11H2,1H3,(H,27,29)(H,28,30)/t13-,14-,18-,21?,22?/m0/s1 |
| InChIKey | NTKXKAGDHARFAK-IYXRFTRUSA-N |
| XLogP | 4.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|