C22H34ClF2N3O2 — CID 170580930
N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide;1-hexyl-1,3-dimethylurea (PubChem CID 170580930) has the molecular formula C22H34ClF2N3O2 and a molecular weight of 445.98 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide;1-hexyl-1,3-dimethylurea.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide;1-hexyl-1,3-dimethylurea |
|---|---|
| PubChem CID | 170580930 |
| Molecular Formula | C22H34ClF2N3O2 |
| Molecular Weight | 445.98 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide;1-hexyl-1,3-dimethylurea |
| SMILES | CCCCCCN(C)C(=O)NC.O=CNC(c1c(F)ccc(Cl)c1F)C1CCCC1 |
| InChI | InChI=1S/C13H14ClF2NO.C9H20N2O/c14-9-5-6-10(15)11(12(9)16)13(17-7-18)8-3-1-2-4-8;1-4-5-6-7-8-11(3)9(12)10-2/h5-8,13H,1-4H2,(H,17,18);4-8H2,1-3H3,(H,10,12) |
| InChIKey | SQCSVVBNTSSDNF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.98 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|