C14H21ClN2O2 — CID 108879927
1-butyl-3-[1-(4-chlorophenoxy)ethyl]-1-methylurea (PubChem CID 108879927) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 1-butyl-3-[1-(4-chlorophenoxy)ethyl]-1-methylurea.
| Compound Name | 1-butyl-3-[1-(4-chlorophenoxy)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 108879927 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-butyl-3-[1-(4-chlorophenoxy)ethyl]-1-methylurea |
| SMILES | CCCCN(C)C(=O)NC(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2O2/c1-4-5-10-17(3)14(18)16-11(2)19-13-8-6-12(15)7-9-13/h6-9,11H,4-5,10H2,1-3H3,(H,16,18) |
| InChIKey | SBCCNPJLYRYRAP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|