C17H28N2O3 — CID 108871094
1,1-dibutyl-3-[1-(4-hydroxyphenoxy)ethyl]urea (PubChem CID 108871094) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1,1-dibutyl-3-[1-(4-hydroxyphenoxy)ethyl]urea.
| Compound Name | 1,1-dibutyl-3-[1-(4-hydroxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 108871094 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1,1-dibutyl-3-[1-(4-hydroxyphenoxy)ethyl]urea |
| SMILES | CCCCN(CCCC)C(=O)NC(C)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C17H28N2O3/c1-4-6-12-19(13-7-5-2)17(21)18-14(3)22-16-10-8-15(20)9-11-16/h8-11,14,20H,4-7,12-13H2,1-3H3,(H,18,21) |
| InChIKey | MSRHOXIENDWXMG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|