C13H14ClF2NO — CID 170579084
N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide (PubChem CID 170579084) has the molecular formula C13H14ClF2NO and a molecular weight of 273.71 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide |
|---|---|
| PubChem CID | 170579084 |
| Molecular Formula | C13H14ClF2NO |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]formamide |
| SMILES | O=CNC(c1c(F)ccc(Cl)c1F)C1CCCC1 |
| InChI | InChI=1S/C13H14ClF2NO/c14-9-5-6-10(15)11(12(9)16)13(17-7-18)8-3-1-2-4-8/h5-8,13H,1-4H2,(H,17,18) |
| InChIKey | UBQNHSZTRNBOAG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|