C19H21ClFNS — CID 170579906
1-(3-chloro-2-fluoro-6-methylphenyl)-1-cyclopentyl-N-phenylsulfanylmethanamine (PubChem CID 170579906) has the molecular formula C19H21ClFNS and a molecular weight of 349.90 g/mol. Its IUPAC name is 1-(3-chloro-2-fluoro-6-methylphenyl)-1-cyclopentyl-N-phenylsulfanylmethanamine.
| Compound Name | 1-(3-chloro-2-fluoro-6-methylphenyl)-1-cyclopentyl-N-phenylsulfanylmethanamine |
|---|---|
| PubChem CID | 170579906 |
| Molecular Formula | C19H21ClFNS |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-(3-chloro-2-fluoro-6-methylphenyl)-1-cyclopentyl-N-phenylsulfanylmethanamine |
| SMILES | Cc1ccc(Cl)c(F)c1C(NSc1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H21ClFNS/c1-13-11-12-16(20)18(21)17(13)19(14-7-5-6-8-14)22-23-15-9-3-2-4-10-15/h2-4,9-12,14,19,22H,5-8H2,1H3 |
| InChIKey | ZULXSFDUGCBQLI-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|