C19H25N3OS — CID 170581976
methane;(3Z)-3-(5-methyl-6-piperidin-4-ylthieno[2,3-c]pyridazin-3-yl)hexa-1,3,5-trien-2-ol (PubChem CID 170581976) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is methane;(3Z)-3-(5-methyl-6-piperidin-4-ylthieno[2,3-c]pyridazin-3-yl)hexa-1,3,5-trien-2-ol.
| Compound Name | methane;(3Z)-3-(5-methyl-6-piperidin-4-ylthieno[2,3-c]pyridazin-3-yl)hexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 170581976 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | methane;(3Z)-3-(5-methyl-6-piperidin-4-ylthieno[2,3-c]pyridazin-3-yl)hexa-1,3,5-trien-2-ol |
| SMILES | C.C=C/C=C(\C(=C)O)c1cc2c(C)c(C3CCNCC3)sc2nn1 |
| InChI | InChI=1S/C18H21N3OS.CH4/c1-4-5-14(12(3)22)16-10-15-11(2)17(23-18(15)21-20-16)13-6-8-19-9-7-13;/h4-5,10,13,19,22H,1,3,6-9H2,2H3;1H4/b14-5+; |
| InChIKey | CSQZMISRWOHLBS-OCSIRBNJSA-N |
| XLogP | 4.74 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|