C15H31NO6SSi — CID 170585072
tert-butyl (4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dioxooxathiazolidine-3-carboxylate (PubChem CID 170585072) has the molecular formula C15H31NO6SSi and a molecular weight of 381.57 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dioxooxathiazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dioxooxathiazolidine-3-carboxylate |
|---|---|
| PubChem CID | 170585072 |
| Molecular Formula | C15H31NO6SSi |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | tert-butyl (4R)-4-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dioxooxathiazolidine-3-carboxylate |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H31NO6SSi/c1-11(22-24(8,9)15(5,6)7)12-10-20-23(18,19)16(12)13(17)21-14(2,3)4/h11-12H,10H2,1-9H3/t11-,12+/m0/s1 |
| InChIKey | MIEMRNLASKPORG-NWDGAFQWSA-N |
| XLogP | 3.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|