C6H11F2N — CID 170585135
(2R)-1,1-difluoro-4-methylpent-4-en-2-amine (PubChem CID 170585135) has the molecular formula C6H11F2N and a molecular weight of 135.16 g/mol. Its IUPAC name is (2R)-1,1-difluoro-4-methylpent-4-en-2-amine.
| Compound Name | (2R)-1,1-difluoro-4-methylpent-4-en-2-amine |
|---|---|
| PubChem CID | 170585135 |
| Molecular Formula | C6H11F2N |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | (2R)-1,1-difluoro-4-methylpent-4-en-2-amine |
| SMILES | C=C(C)C[C@@H](N)C(F)F |
| InChI | InChI=1S/C6H11F2N/c1-4(2)3-5(9)6(7)8/h5-6H,1,3,9H2,2H3/t5-/m1/s1 |
| InChIKey | SPCRSOYQDAEZKL-RXMQYKEDSA-N |
| XLogP | 1.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|