C27H29F3N2O — CID 170588777
(E)-3-[2-(dimethylamino)-5-[2-(dimethylamino)ethyl]phenyl]-4,4,4-trifluoro-2-(5-methylnaphthalen-1-yl)but-2-enal (PubChem CID 170588777) has the molecular formula C27H29F3N2O and a molecular weight of 454.54 g/mol. Its IUPAC name is (E)-3-[2-(dimethylamino)-5-[2-(dimethylamino)ethyl]phenyl]-4,4,4-trifluoro-2-(5-methylnaphthalen-1-yl)but-2-enal.
| Compound Name | (E)-3-[2-(dimethylamino)-5-[2-(dimethylamino)ethyl]phenyl]-4,4,4-trifluoro-2-(5-methylnaphthalen-1-yl)but-2-enal |
|---|---|
| PubChem CID | 170588777 |
| Molecular Formula | C27H29F3N2O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (E)-3-[2-(dimethylamino)-5-[2-(dimethylamino)ethyl]phenyl]-4,4,4-trifluoro-2-(5-methylnaphthalen-1-yl)but-2-enal |
| SMILES | Cc1cccc2c(/C(C=O)=C(/c3cc(CCN(C)C)ccc3N(C)C)C(F)(F)F)cccc12 |
| InChI | InChI=1S/C27H29F3N2O/c1-18-8-6-10-21-20(18)9-7-11-22(21)24(17-33)26(27(28,29)30)23-16-19(14-15-31(2)3)12-13-25(23)32(4)5/h6-13,16-17H,14-15H2,1-5H3/b26-24- |
| InChIKey | YOPCHCVETCLTPE-LCUIJRPUSA-N |
| XLogP | 5.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|