C18H23BF3NO3 — CID 177027578
(E)-3-[2-(dimethylamino)phenyl]-4,4,4-trifluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enal (PubChem CID 177027578) has the molecular formula C18H23BF3NO3 and a molecular weight of 369.19 g/mol. Its IUPAC name is (E)-3-[2-(dimethylamino)phenyl]-4,4,4-trifluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enal.
| Compound Name | (E)-3-[2-(dimethylamino)phenyl]-4,4,4-trifluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enal |
|---|---|
| PubChem CID | 177027578 |
| Molecular Formula | C18H23BF3NO3 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (E)-3-[2-(dimethylamino)phenyl]-4,4,4-trifluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enal |
| SMILES | CN(C)c1ccccc1/C(=C(\C=O)B1OC(C)(C)C(C)(C)O1)C(F)(F)F |
| InChI | InChI=1S/C18H23BF3NO3/c1-16(2)17(3,4)26-19(25-16)13(11-24)15(18(20,21)22)12-9-7-8-10-14(12)23(5)6/h7-11H,1-6H3/b15-13- |
| InChIKey | JQNZBACYJLNDLJ-SQFISAMPSA-N |
| XLogP | 3.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|