About 4-methylpiperidin-4-ol;(E)-non-4-ene
4-methylpiperidin-4-ol;(E)-non-4-ene (PubChem CID 170590699) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is 4-methylpiperidin-4-ol;(E)-non-4-ene.
Molecular Properties
| Compound Name | 4-methylpiperidin-4-ol;(E)-non-4-ene |
| PubChem CID | 170590699 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 4-methylpiperidin-4-ol;(E)-non-4-ene |
| SMILES | CC1(O)CCNCC1.CCC/C=C/CCCC |
| InChI | InChI=1S/C9H18.C6H13NO/c1-3-5-7-9-8-6-4-2;1-6(8)2-4-7-5-3-6/h7,9H,3-6,8H2,1-2H3;7-8H,2-5H2,1H3/b9-7+; |
| InChIKey | FCMSJHIPIKOUML-BXTVWIJMSA-N |
| XLogP | 3.65 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpiperidin-4-ol;(E)-non-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpiperidin-4-ol;(E)-non-4-ene?
The IUPAC name of 4-methylpiperidin-4-ol;(E)-non-4-ene (CID 170590699) is 4-methylpiperidin-4-ol;(E)-non-4-ene.
What is the SMILES notation for 4-methylpiperidin-4-ol;(E)-non-4-ene?
The canonical SMILES for 4-methylpiperidin-4-ol;(E)-non-4-ene is CC1(O)CCNCC1.CCC/C=C/CCCC.
What is the InChIKey of 4-methylpiperidin-4-ol;(E)-non-4-ene?
The InChIKey is FCMSJHIPIKOUML-BXTVWIJMSA-N. The full InChI is InChI=1S/C9H18.C6H13NO/c1-3-5-7-9-8-6-4-2;1-6(8)2-4-7-5-3-6/h7,9H,3-6,8H2,1-2H3;7-8H,2-5H2,1H3/b9-7+;.
What are the key properties of 4-methylpiperidin-4-ol;(E)-non-4-ene?
4-methylpiperidin-4-ol;(E)-non-4-ene has a molecular weight of 241.42 g/mol, XLogP of 3.65, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpiperidin-4-ol;(E)-non-4-ene is sourced from PubChem (CID 170590699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).