C33H41N7O3 — CID 170593145
[5-[[1-butyl-3-(2,6-dimethylphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]methyl prop-2-enoate (PubChem CID 170593145) has the molecular formula C33H41N7O3 and a molecular weight of 583.74 g/mol. Its IUPAC name is [5-[[1-butyl-3-(2,6-dimethylphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]methyl prop-2-enoate.
| Compound Name | [5-[[1-butyl-3-(2,6-dimethylphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 170593145 |
| Molecular Formula | C33H41N7O3 |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | [5-[[1-butyl-3-(2,6-dimethylphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCc1cc(Nc2ncc3c(n2)N(CCCC)C(=O)N(c2c(C)cccc2C)C3)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C33H41N7O3/c1-6-8-14-39-31-26(21-40(33(39)42)30-23(3)10-9-11-24(30)4)20-34-32(36-31)35-27-12-13-28(38-17-15-37(5)16-18-38)25(19-27)22-43-29(41)7-2/h7,9-13,19-20H,2,6,8,14-18,21-22H2,1,3-5H3,(H,34,35,36) |
| InChIKey | YZALWULJGFJHPH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|