C31H39N7O4 — CID 170335580
methyl 5-[[3-(2,6-dimethylphenyl)-1-(4-hydroxybutyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-2-(4-methylpiperazin-1-yl)benzoate (PubChem CID 170335580) has the molecular formula C31H39N7O4 and a molecular weight of 573.70 g/mol. Its IUPAC name is methyl 5-[[3-(2,6-dimethylphenyl)-1-(4-hydroxybutyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-2-(4-methylpiperazin-1-yl)benzoate.
| Compound Name | methyl 5-[[3-(2,6-dimethylphenyl)-1-(4-hydroxybutyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-2-(4-methylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 170335580 |
| Molecular Formula | C31H39N7O4 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | methyl 5-[[3-(2,6-dimethylphenyl)-1-(4-hydroxybutyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]-2-(4-methylpiperazin-1-yl)benzoate |
| SMILES | COC(=O)c1cc(Nc2ncc3c(n2)N(CCCCO)C(=O)N(c2c(C)cccc2C)C3)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C31H39N7O4/c1-21-8-7-9-22(2)27(21)38-20-23-19-32-30(34-28(23)37(31(38)41)12-5-6-17-39)33-24-10-11-26(25(18-24)29(40)42-4)36-15-13-35(3)14-16-36/h7-11,18-19,39H,5-6,12-17,20H2,1-4H3,(H,32,33,34) |
| InChIKey | NWMWKOYLKMSIBC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|