C17H22Cl2FN5O2 — CID 170594085
tert-butyl 4-(2,7-dichloro-8-fluoro-2-methyl-1H-pyrido[4,3-d]pyrimidin-4-yl)piperazine-1-carboxylate (PubChem CID 170594085) has the molecular formula C17H22Cl2FN5O2 and a molecular weight of 418.30 g/mol. Its IUPAC name is tert-butyl 4-(2,7-dichloro-8-fluoro-2-methyl-1H-pyrido[4,3-d]pyrimidin-4-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,7-dichloro-8-fluoro-2-methyl-1H-pyrido[4,3-d]pyrimidin-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170594085 |
| Molecular Formula | C17H22Cl2FN5O2 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | tert-butyl 4-(2,7-dichloro-8-fluoro-2-methyl-1H-pyrido[4,3-d]pyrimidin-4-yl)piperazine-1-carboxylate |
| SMILES | CC1(Cl)N=C(N2CCN(C(=O)OC(C)(C)C)CC2)c2cnc(Cl)c(F)c2N1 |
| InChI | InChI=1S/C17H22Cl2FN5O2/c1-16(2,3)27-15(26)25-7-5-24(6-8-25)14-10-9-21-13(18)11(20)12(10)22-17(4,19)23-14/h9,22H,5-8H2,1-4H3 |
| InChIKey | OLNHNCLHSNAZLA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|