C18H12ClF4N5O — CID 170594924
7-[5-amino-4-chloro-3-methyl-2-(trifluoromethyl)phenyl]-5-ethynyl-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-amine (PubChem CID 170594924) has the molecular formula C18H12ClF4N5O and a molecular weight of 425.77 g/mol. Its IUPAC name is 7-[5-amino-4-chloro-3-methyl-2-(trifluoromethyl)phenyl]-5-ethynyl-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 7-[5-amino-4-chloro-3-methyl-2-(trifluoromethyl)phenyl]-5-ethynyl-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 170594924 |
| Molecular Formula | C18H12ClF4N5O |
| Molecular Weight | 425.77 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 7-[5-amino-4-chloro-3-methyl-2-(trifluoromethyl)phenyl]-5-ethynyl-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-amine |
| SMILES | C#Cc1nc(-c2cc(N)c(Cl)c(C)c2C(F)(F)F)c(F)c2nc(OC)nc(N)c12 |
| InChI | InChI=1S/C18H12ClF4N5O/c1-4-9-10-15(27-17(29-3)28-16(10)25)13(20)14(26-9)7-5-8(24)12(19)6(2)11(7)18(21,22)23/h1,5H,24H2,2-3H3,(H2,25,27,28) |
| InChIKey | XUGCIMGFFODJCY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.77 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|