C50H87BN10O17 — CID 170595522
CID 170595522 (PubChem CID 170595522) has the molecular formula C50H87BN10O17 and a molecular weight of 1111.11 g/mol.
| Compound Name | CID 170595522 |
|---|---|
| PubChem CID | 170595522 |
| Molecular Formula | C50H87BN10O17 |
| Molecular Weight | 1111.11 g/mol |
| Exact Mass | 1110.63 |
| IUPAC Name | — |
| SMILES | CCC.[B]Cc1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)CNC(=O)CCOCCN2C(=O)CCC2=O)cc1CN(C)C(=O)OC/C(N)=C/N(N)CCOCCOCCOCCOCCOCCOCCOCCOC |
| InChI | InChI=1S/C47H79BN10O17.C3H8/c1-56(47(65)75-35-38(49)34-57(51)11-14-68-18-19-70-22-23-72-26-27-74-29-28-73-25-24-71-21-20-69-17-16-66-2)33-37-30-39(6-5-36(37)31-48)54-45(63)40(4-3-10-52-46(50)64)55-42(60)32-53-41(59)9-13-67-15-12-58-43(61)7-8-44(58)62;1-3-2/h5-6,30,34,40H,3-4,7-29,31-33,35,49,51H2,1-2H3,(H,53,59)(H,54,63)(H,55,60)(H3,50,52,64);3H2,1-2H3/b38-34-;/t40-;/m0./s1 |
| InChIKey | MMCOZIUTWDYPSW-FRRXWOCJSA-N |
| XLogP | -0.38 |
| TPSA | 347.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1111.11 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|