C24H29ClN4O2 — CID 170596497
N-[3-[4-[[(E,2Z)-3-chloro-2-ethylidenepent-3-enoyl]amino]cyclohexyl]-1-methylpyrazol-5-yl]benzamide (PubChem CID 170596497) has the molecular formula C24H29ClN4O2 and a molecular weight of 440.98 g/mol. Its IUPAC name is N-[3-[4-[[(E,2Z)-3-chloro-2-ethylidenepent-3-enoyl]amino]cyclohexyl]-1-methylpyrazol-5-yl]benzamide.
| Compound Name | N-[3-[4-[[(E,2Z)-3-chloro-2-ethylidenepent-3-enoyl]amino]cyclohexyl]-1-methylpyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 170596497 |
| Molecular Formula | C24H29ClN4O2 |
| Molecular Weight | 440.98 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-[3-[4-[[(E,2Z)-3-chloro-2-ethylidenepent-3-enoyl]amino]cyclohexyl]-1-methylpyrazol-5-yl]benzamide |
| SMILES | C/C=C(C(=O)NC1CCC(c2cc(NC(=O)c3ccccc3)n(C)n2)CC1)\C(Cl)=C/C |
| InChI | InChI=1S/C24H29ClN4O2/c1-4-19(20(25)5-2)24(31)26-18-13-11-16(12-14-18)21-15-22(29(3)28-21)27-23(30)17-9-7-6-8-10-17/h4-10,15-16,18H,11-14H2,1-3H3,(H,26,31)(H,27,30)/b19-4+,20-5+ |
| InChIKey | FYHIHLKHESQFII-SMSSLPFESA-N |
| XLogP | 4.90 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|