C16H17F5N2O3 — CID 170597362
3-[(1-methylpyrrolidine-2-carbonyl)amino]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid (PubChem CID 170597362) has the molecular formula C16H17F5N2O3 and a molecular weight of 380.31 g/mol. Its IUPAC name is 3-[(1-methylpyrrolidine-2-carbonyl)amino]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid.
| Compound Name | 3-[(1-methylpyrrolidine-2-carbonyl)amino]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 170597362 |
| Molecular Formula | C16H17F5N2O3 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-[(1-methylpyrrolidine-2-carbonyl)amino]-4-(2,3,4,5,6-pentafluorophenyl)butanoic acid |
| SMILES | CN1CCCC1C(=O)NC(CC(=O)O)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H17F5N2O3/c1-23-4-2-3-9(23)16(26)22-7(6-10(24)25)5-8-11(17)13(19)15(21)14(20)12(8)18/h7,9H,2-6H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | UXKUDNSEYTVRKR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|