About [butanoyl(formyl)amino] 5-methylhexanoate
[butanoyl(formyl)amino] 5-methylhexanoate (PubChem CID 170597603) has the molecular formula C12H21NO4
and a molecular weight of 243.30 g/mol. Its IUPAC name is [butanoyl(formyl)amino] 5-methylhexanoate.
Molecular Properties
| Compound Name | [butanoyl(formyl)amino] 5-methylhexanoate |
| PubChem CID | 170597603 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | [butanoyl(formyl)amino] 5-methylhexanoate |
| SMILES | CCCC(=O)N(C=O)OC(=O)CCCC(C)C |
| InChI | InChI=1S/C12H21NO4/c1-4-6-11(15)13(9-14)17-12(16)8-5-7-10(2)3/h9-10H,4-8H2,1-3H3 |
| InChIKey | UNPSSWKQDXWGFO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [butanoyl(formyl)amino] 5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butanoyl(formyl)amino] 5-methylhexanoate?
The IUPAC name of [butanoyl(formyl)amino] 5-methylhexanoate (CID 170597603) is [butanoyl(formyl)amino] 5-methylhexanoate.
What is the SMILES notation for [butanoyl(formyl)amino] 5-methylhexanoate?
The canonical SMILES for [butanoyl(formyl)amino] 5-methylhexanoate is CCCC(=O)N(C=O)OC(=O)CCCC(C)C.
What is the InChIKey of [butanoyl(formyl)amino] 5-methylhexanoate?
The InChIKey is UNPSSWKQDXWGFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4/c1-4-6-11(15)13(9-14)17-12(16)8-5-7-10(2)3/h9-10H,4-8H2,1-3H3.
What are the key properties of [butanoyl(formyl)amino] 5-methylhexanoate?
[butanoyl(formyl)amino] 5-methylhexanoate has a molecular weight of 243.30 g/mol, XLogP of 2.06, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [butanoyl(formyl)amino] 5-methylhexanoate is sourced from PubChem (CID 170597603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).