About [butanoyl(formyl)amino] hydrogen carbonate
[butanoyl(formyl)amino] hydrogen carbonate (PubChem CID 123497102) has the molecular formula C6H9NO5
and a molecular weight of 175.14 g/mol. Its IUPAC name is [butanoyl(formyl)amino] hydrogen carbonate.
Molecular Properties
| Compound Name | [butanoyl(formyl)amino] hydrogen carbonate |
| PubChem CID | 123497102 |
| Molecular Formula | C6H9NO5 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | [butanoyl(formyl)amino] hydrogen carbonate |
| SMILES | CCCC(=O)N(C=O)OC(=O)O |
| InChI | InChI=1S/C6H9NO5/c1-2-3-5(9)7(4-8)12-6(10)11/h4H,2-3H2,1H3,(H,10,11) |
| InChIKey | XNQOMLPPRVHMGO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [butanoyl(formyl)amino] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butanoyl(formyl)amino] hydrogen carbonate?
The IUPAC name of [butanoyl(formyl)amino] hydrogen carbonate (CID 123497102) is [butanoyl(formyl)amino] hydrogen carbonate.
What is the SMILES notation for [butanoyl(formyl)amino] hydrogen carbonate?
The canonical SMILES for [butanoyl(formyl)amino] hydrogen carbonate is CCCC(=O)N(C=O)OC(=O)O.
What is the InChIKey of [butanoyl(formyl)amino] hydrogen carbonate?
The InChIKey is XNQOMLPPRVHMGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO5/c1-2-3-5(9)7(4-8)12-6(10)11/h4H,2-3H2,1H3,(H,10,11).
What are the key properties of [butanoyl(formyl)amino] hydrogen carbonate?
[butanoyl(formyl)amino] hydrogen carbonate has a molecular weight of 175.14 g/mol, XLogP of 0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [butanoyl(formyl)amino] hydrogen carbonate is sourced from PubChem (CID 123497102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).