C18H24N2O6 — CID 167044233
[butanoyl(formyl)amino] 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate (PubChem CID 167044233) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is [butanoyl(formyl)amino] 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate.
| Compound Name | [butanoyl(formyl)amino] 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 167044233 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [butanoyl(formyl)amino] 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate |
| SMILES | CCCC(=O)N(C=O)OC(=O)c1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O6/c1-5-6-15(22)20(12-21)26-16(23)14-9-7-13(8-10-14)11-19-17(24)25-18(2,3)4/h7-10,12H,5-6,11H2,1-4H3,(H,19,24) |
| InChIKey | FSPMERRLIILKRA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|