C15H18N2O8 — CID 146640529
1-O-[butanoyl(formyl)amino] 3-O-(2,5-dioxopyrrolidin-1-yl) cyclobutane-1,3-dicarboxylate (PubChem CID 146640529) has the molecular formula C15H18N2O8 and a molecular weight of 354.32 g/mol. Its IUPAC name is 1-O-[butanoyl(formyl)amino] 3-O-(2,5-dioxopyrrolidin-1-yl) cyclobutane-1,3-dicarboxylate.
| Compound Name | 1-O-[butanoyl(formyl)amino] 3-O-(2,5-dioxopyrrolidin-1-yl) cyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 146640529 |
| Molecular Formula | C15H18N2O8 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-O-[butanoyl(formyl)amino] 3-O-(2,5-dioxopyrrolidin-1-yl) cyclobutane-1,3-dicarboxylate |
| SMILES | CCCC(=O)N(C=O)OC(=O)C1CC(C(=O)ON2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C15H18N2O8/c1-2-3-11(19)16(8-18)24-14(22)9-6-10(7-9)15(23)25-17-12(20)4-5-13(17)21/h8-10H,2-7H2,1H3 |
| InChIKey | SGWQHNVSJIEPLR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|