C9H8F9NO5S — CID 88963780
[butanoyl(formyl)amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 88963780) has the molecular formula C9H8F9NO5S and a molecular weight of 413.21 g/mol. Its IUPAC name is [butanoyl(formyl)amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [butanoyl(formyl)amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 88963780 |
| Molecular Formula | C9H8F9NO5S |
| Molecular Weight | 413.21 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | [butanoyl(formyl)amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCC(=O)N(C=O)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F9NO5S/c1-2-3-5(21)19(4-20)24-25(22,23)9(17,18)7(12,13)6(10,11)8(14,15)16/h4H,2-3H2,1H3 |
| InChIKey | DDLKSSFGIISKMU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|