C13H17F9O4S3 — CID 139912240
[1-(2-oxopentyl)-1,4-dithian-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139912240) has the molecular formula C13H17F9O4S3 and a molecular weight of 504.46 g/mol. Its IUPAC name is [1-(2-oxopentyl)-1,4-dithian-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [1-(2-oxopentyl)-1,4-dithian-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139912240 |
| Molecular Formula | C13H17F9O4S3 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | [1-(2-oxopentyl)-1,4-dithian-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCCC(=O)CS1(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCSCC1 |
| InChI | InChI=1S/C13H17F9O4S3/c1-2-3-9(23)8-28(6-4-27-5-7-28)26-29(24,25)13(21,22)11(16,17)10(14,15)12(18,19)20/h2-8H2,1H3 |
| InChIKey | KUILQVQSZXTWNK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|