C17H17F17O4S3 — CID 139912141
[1-(3-methyl-2-oxobutyl)-1,4-dithian-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 139912141) has the molecular formula C17H17F17O4S3 and a molecular weight of 704.49 g/mol. Its IUPAC name is [1-(3-methyl-2-oxobutyl)-1,4-dithian-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | [1-(3-methyl-2-oxobutyl)-1,4-dithian-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 139912141 |
| Molecular Formula | C17H17F17O4S3 |
| Molecular Weight | 704.49 g/mol |
| Exact Mass | 704.00 |
| IUPAC Name | [1-(3-methyl-2-oxobutyl)-1,4-dithian-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | CC(C)C(=O)CS1(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCSCC1 |
| InChI | InChI=1S/C17H17F17O4S3/c1-8(2)9(35)7-40(5-3-39-4-6-40)38-41(36,37)17(33,34)15(28,29)13(24,25)11(20,21)10(18,19)12(22,23)14(26,27)16(30,31)32/h8H,3-7H2,1-2H3 |
| InChIKey | SKFGVBPDALNVAL-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.49 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|