About [butanoyl(formyl)amino] 2-acetylsulfanylacetate
[butanoyl(formyl)amino] 2-acetylsulfanylacetate (PubChem CID 142170109) has the molecular formula C9H13NO5S
and a molecular weight of 247.27 g/mol. Its IUPAC name is [butanoyl(formyl)amino] 2-acetylsulfanylacetate.
Molecular Properties
| Compound Name | [butanoyl(formyl)amino] 2-acetylsulfanylacetate |
| PubChem CID | 142170109 |
| Molecular Formula | C9H13NO5S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | [butanoyl(formyl)amino] 2-acetylsulfanylacetate |
| SMILES | CCCC(=O)N(C=O)OC(=O)CSC(C)=O |
| InChI | InChI=1S/C9H13NO5S/c1-3-4-8(13)10(6-11)15-9(14)5-16-7(2)12/h6H,3-5H2,1-2H3 |
| InChIKey | PNUKJVAOEQAYMX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [butanoyl(formyl)amino] 2-acetylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butanoyl(formyl)amino] 2-acetylsulfanylacetate?
The IUPAC name of [butanoyl(formyl)amino] 2-acetylsulfanylacetate (CID 142170109) is [butanoyl(formyl)amino] 2-acetylsulfanylacetate.
What is the SMILES notation for [butanoyl(formyl)amino] 2-acetylsulfanylacetate?
The canonical SMILES for [butanoyl(formyl)amino] 2-acetylsulfanylacetate is CCCC(=O)N(C=O)OC(=O)CSC(C)=O.
What is the InChIKey of [butanoyl(formyl)amino] 2-acetylsulfanylacetate?
The InChIKey is PNUKJVAOEQAYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO5S/c1-3-4-8(13)10(6-11)15-9(14)5-16-7(2)12/h6H,3-5H2,1-2H3.
What are the key properties of [butanoyl(formyl)amino] 2-acetylsulfanylacetate?
[butanoyl(formyl)amino] 2-acetylsulfanylacetate has a molecular weight of 247.27 g/mol, XLogP of 0.51, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [butanoyl(formyl)amino] 2-acetylsulfanylacetate is sourced from PubChem (CID 142170109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).