About ethenyl 2-acetylsulfanylacetate
ethenyl 2-acetylsulfanylacetate (PubChem CID 139751778) has the molecular formula C6H8O3S
and a molecular weight of 160.19 g/mol. Its IUPAC name is ethenyl 2-acetylsulfanylacetate.
Molecular Properties
| Compound Name | ethenyl 2-acetylsulfanylacetate |
| PubChem CID | 139751778 |
| Molecular Formula | C6H8O3S |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | ethenyl 2-acetylsulfanylacetate |
| SMILES | C=COC(=O)CSC(C)=O |
| InChI | InChI=1S/C6H8O3S/c1-3-9-6(8)4-10-5(2)7/h3H,1,4H2,2H3 |
| InChIKey | XZFZSOAGUICCSU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 2-acetylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 2-acetylsulfanylacetate?
The IUPAC name of ethenyl 2-acetylsulfanylacetate (CID 139751778) is ethenyl 2-acetylsulfanylacetate.
What is the SMILES notation for ethenyl 2-acetylsulfanylacetate?
The canonical SMILES for ethenyl 2-acetylsulfanylacetate is C=COC(=O)CSC(C)=O.
What is the InChIKey of ethenyl 2-acetylsulfanylacetate?
The InChIKey is XZFZSOAGUICCSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3S/c1-3-9-6(8)4-10-5(2)7/h3H,1,4H2,2H3.
What are the key properties of ethenyl 2-acetylsulfanylacetate?
ethenyl 2-acetylsulfanylacetate has a molecular weight of 160.19 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 2-acetylsulfanylacetate is sourced from PubChem (CID 139751778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).