C6H8FNO — CID 170598698
4-ethyl-3-(fluoromethyl)-1,2-oxazole (PubChem CID 170598698) has the molecular formula C6H8FNO and a molecular weight of 129.13 g/mol. Its IUPAC name is 4-ethyl-3-(fluoromethyl)-1,2-oxazole.
| Compound Name | 4-ethyl-3-(fluoromethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 170598698 |
| Molecular Formula | C6H8FNO |
| Molecular Weight | 129.13 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 4-ethyl-3-(fluoromethyl)-1,2-oxazole |
| SMILES | CCc1conc1CF |
| InChI | InChI=1S/C6H8FNO/c1-2-5-4-9-8-6(5)3-7/h4H,2-3H2,1H3 |
| InChIKey | RIFMDVFBKGTFIO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |