C15H16N6O3S2 — CID 17059936
4-[[1-hydroxy-2-(1-phenyltetrazol-5-yl)sulfanylethyl]amino]benzenesulfonamide (PubChem CID 17059936) has the molecular formula C15H16N6O3S2 and a molecular weight of 392.47 g/mol. Its IUPAC name is 4-[[1-hydroxy-2-(1-phenyltetrazol-5-yl)sulfanylethyl]amino]benzenesulfonamide.
| Compound Name | 4-[[1-hydroxy-2-(1-phenyltetrazol-5-yl)sulfanylethyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 17059936 |
| Molecular Formula | C15H16N6O3S2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 4-[[1-hydroxy-2-(1-phenyltetrazol-5-yl)sulfanylethyl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NC(O)CSc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H16N6O3S2/c16-26(23,24)13-8-6-11(7-9-13)17-14(22)10-25-15-18-19-20-21(15)12-4-2-1-3-5-12/h1-9,14,17,22H,10H2,(H2,16,23,24) |
| InChIKey | DHCKUNRQPYEDRJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|