C9H18N2 — CID 170600728
(6R)-6-methyl-4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine (PubChem CID 170600728) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (6R)-6-methyl-4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine.
| Compound Name | (6R)-6-methyl-4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine |
|---|---|
| PubChem CID | 170600728 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (6R)-6-methyl-4-propan-2-yl-3,6-dihydro-2H-pyridin-1-amine |
| SMILES | CC(C)C1=C[C@@H](C)N(N)CC1 |
| InChI | InChI=1S/C9H18N2/c1-7(2)9-4-5-11(10)8(3)6-9/h6-8H,4-5,10H2,1-3H3/t8-/m1/s1 |
| InChIKey | WKOLDAVVXNXQRI-MRVPVSSYSA-N |
| XLogP | 1.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|