C10H20N2 — CID 57216663
1-(2,4-dimethylcyclopent-3-en-1-yl)-1-propylhydrazine (PubChem CID 57216663) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-(2,4-dimethylcyclopent-3-en-1-yl)-1-propylhydrazine.
| Compound Name | 1-(2,4-dimethylcyclopent-3-en-1-yl)-1-propylhydrazine |
|---|---|
| PubChem CID | 57216663 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-(2,4-dimethylcyclopent-3-en-1-yl)-1-propylhydrazine |
| SMILES | CCCN(N)C1CC(C)=CC1C |
| InChI | InChI=1S/C10H20N2/c1-4-5-12(11)10-7-8(2)6-9(10)3/h6,9-10H,4-5,7,11H2,1-3H3 |
| InChIKey | NYYFXRXABORSOD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|