C10H20N2 — CID 20651675
1-methyl-1-(3,5,6-trimethylcyclohex-3-en-1-yl)hydrazine (PubChem CID 20651675) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-methyl-1-(3,5,6-trimethylcyclohex-3-en-1-yl)hydrazine.
| Compound Name | 1-methyl-1-(3,5,6-trimethylcyclohex-3-en-1-yl)hydrazine |
|---|---|
| PubChem CID | 20651675 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-methyl-1-(3,5,6-trimethylcyclohex-3-en-1-yl)hydrazine |
| SMILES | CC1=CC(C)C(C)C(N(C)N)C1 |
| InChI | InChI=1S/C10H20N2/c1-7-5-8(2)9(3)10(6-7)12(4)11/h5,8-10H,6,11H2,1-4H3 |
| InChIKey | QBMVAEMEQCZFRK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|