C11H16BNO3 — CID 170600987
4-ethyl-2-(2-hydroxyoxaborinan-5-yl)oxypyridine (PubChem CID 170600987) has the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. Its IUPAC name is 4-ethyl-2-(2-hydroxyoxaborinan-5-yl)oxypyridine.
| Compound Name | 4-ethyl-2-(2-hydroxyoxaborinan-5-yl)oxypyridine |
|---|---|
| PubChem CID | 170600987 |
| Molecular Formula | C11H16BNO3 |
| Molecular Weight | 221.06 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-ethyl-2-(2-hydroxyoxaborinan-5-yl)oxypyridine |
| SMILES | CCc1ccnc(OC2CCB(O)OC2)c1 |
| InChI | InChI=1S/C11H16BNO3/c1-2-9-4-6-13-11(7-9)16-10-3-5-12(14)15-8-10/h4,6-7,10,14H,2-3,5,8H2,1H3 |
| InChIKey | DYULBBKNSYJIBJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.06 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|