C21H28N5O4Sb — CID 170602603
CID 170602603 (PubChem CID 170602603) has the molecular formula C21H28N5O4Sb and a molecular weight of 536.25 g/mol.
| Compound Name | CID 170602603 |
|---|---|
| PubChem CID | 170602603 |
| Molecular Formula | C21H28N5O4Sb |
| Molecular Weight | 536.25 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | — |
| SMILES | C/N=C(\C(N)=O)c1cc(OCc2ccccn2)ccc1N.O=CCCCN([Sb])CCO |
| InChI | InChI=1S/C15H16N4O2.C6H12NO2.Sb/c1-18-14(15(17)20)12-8-11(5-6-13(12)16)21-9-10-4-2-3-7-19-10;8-5-2-1-3-7-4-6-9;/h2-8H,9,16H2,1H3,(H2,17,20);5,9H,1-4,6H2;/q;-1;+1/b18-14-;; |
| InChIKey | QQLNYIFUTGYHHO-RQNMHTNWSA-N |
| XLogP | 0.49 |
| TPSA | 144.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|