C20H23F2N5O2 — CID 170418557
2-[2-amino-5-(pyridin-2-ylmethoxy)phenyl]-N-(3,3-difluoropiperidin-4-yl)-2-methyliminoacetamide (PubChem CID 170418557) has the molecular formula C20H23F2N5O2 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-[2-amino-5-(pyridin-2-ylmethoxy)phenyl]-N-(3,3-difluoropiperidin-4-yl)-2-methyliminoacetamide.
| Compound Name | 2-[2-amino-5-(pyridin-2-ylmethoxy)phenyl]-N-(3,3-difluoropiperidin-4-yl)-2-methyliminoacetamide |
|---|---|
| PubChem CID | 170418557 |
| Molecular Formula | C20H23F2N5O2 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 2-[2-amino-5-(pyridin-2-ylmethoxy)phenyl]-N-(3,3-difluoropiperidin-4-yl)-2-methyliminoacetamide |
| SMILES | C/N=C(\C(=O)NC1CCNCC1(F)F)c1cc(OCc2ccccn2)ccc1N |
| InChI | InChI=1S/C20H23F2N5O2/c1-24-18(19(28)27-17-7-9-25-12-20(17,21)22)15-10-14(5-6-16(15)23)29-11-13-4-2-3-8-26-13/h2-6,8,10,17,25H,7,9,11-12,23H2,1H3,(H,27,28)/b24-18- |
| InChIKey | BKLCZSUPMUEFGY-MOHJPFBDSA-N |
| XLogP | 1.78 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|