C20H22F2N4O2 — CID 170602908
2-(2-amino-5-phenylmethoxyphenyl)-N-[(3R)-4,4-difluoropyrrolidin-3-yl]-2-methyliminoacetamide (PubChem CID 170602908) has the molecular formula C20H22F2N4O2 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-(2-amino-5-phenylmethoxyphenyl)-N-[(3R)-4,4-difluoropyrrolidin-3-yl]-2-methyliminoacetamide.
| Compound Name | 2-(2-amino-5-phenylmethoxyphenyl)-N-[(3R)-4,4-difluoropyrrolidin-3-yl]-2-methyliminoacetamide |
|---|---|
| PubChem CID | 170602908 |
| Molecular Formula | C20H22F2N4O2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-(2-amino-5-phenylmethoxyphenyl)-N-[(3R)-4,4-difluoropyrrolidin-3-yl]-2-methyliminoacetamide |
| SMILES | C/N=C(\C(=O)N[C@@H]1CNCC1(F)F)c1cc(OCc2ccccc2)ccc1N |
| InChI | InChI=1S/C20H22F2N4O2/c1-24-18(19(27)26-17-10-25-12-20(17,21)22)15-9-14(7-8-16(15)23)28-11-13-5-3-2-4-6-13/h2-9,17,25H,10-12,23H2,1H3,(H,26,27)/b24-18-/t17-/m1/s1 |
| InChIKey | UKTZJNOQXRQZOI-KJCFGCQTSA-N |
| XLogP | 1.99 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|