C22H27FN4O4 — CID 170602950
2-[2-amino-5-[(2-fluorophenyl)methoxy]phenyl]-N-[2-formyl-1-hydroxy-4-(methylamino)butan-2-yl]-2-methyliminoacetamide (PubChem CID 170602950) has the molecular formula C22H27FN4O4 and a molecular weight of 430.48 g/mol. Its IUPAC name is 2-[2-amino-5-[(2-fluorophenyl)methoxy]phenyl]-N-[2-formyl-1-hydroxy-4-(methylamino)butan-2-yl]-2-methyliminoacetamide.
| Compound Name | 2-[2-amino-5-[(2-fluorophenyl)methoxy]phenyl]-N-[2-formyl-1-hydroxy-4-(methylamino)butan-2-yl]-2-methyliminoacetamide |
|---|---|
| PubChem CID | 170602950 |
| Molecular Formula | C22H27FN4O4 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[2-amino-5-[(2-fluorophenyl)methoxy]phenyl]-N-[2-formyl-1-hydroxy-4-(methylamino)butan-2-yl]-2-methyliminoacetamide |
| SMILES | C/N=C(\C(=O)NC(C=O)(CO)CCNC)c1cc(OCc2ccccc2F)ccc1N |
| InChI | InChI=1S/C22H27FN4O4/c1-25-10-9-22(13-28,14-29)27-21(30)20(26-2)17-11-16(7-8-19(17)24)31-12-15-5-3-4-6-18(15)23/h3-8,11,13,25,29H,9-10,12,14,24H2,1-2H3,(H,27,30)/b26-20- |
| InChIKey | KCWDJQOKAZNRHC-QOMWVZHYSA-N |
| XLogP | 1.06 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|