C19H19FN6O2 — CID 170602709
2-[2-amino-5-[(2-fluoro-3-pyridinyl)methoxy]phenyl]-2-methylimino-N-(1-methylpyrazol-3-yl)acetamide (PubChem CID 170602709) has the molecular formula C19H19FN6O2 and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-[2-amino-5-[(2-fluoro-3-pyridinyl)methoxy]phenyl]-2-methylimino-N-(1-methylpyrazol-3-yl)acetamide.
| Compound Name | 2-[2-amino-5-[(2-fluoro-3-pyridinyl)methoxy]phenyl]-2-methylimino-N-(1-methylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 170602709 |
| Molecular Formula | C19H19FN6O2 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[2-amino-5-[(2-fluoro-3-pyridinyl)methoxy]phenyl]-2-methylimino-N-(1-methylpyrazol-3-yl)acetamide |
| SMILES | C/N=C(\C(=O)Nc1ccn(C)n1)c1cc(OCc2cccnc2F)ccc1N |
| InChI | InChI=1S/C19H19FN6O2/c1-22-17(19(27)24-16-7-9-26(2)25-16)14-10-13(5-6-15(14)21)28-11-12-4-3-8-23-18(12)20/h3-10H,11,21H2,1-2H3,(H,24,25,27)/b22-17- |
| InChIKey | GBQXMIXKLZDCJD-XLNRJJMWSA-N |
| XLogP | 2.17 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|