C15H14FN3O3 — CID 170602524
2-[2-amino-5-[(2-fluoro-3-pyridinyl)methoxy]phenyl]-2-methyliminoacetic acid (PubChem CID 170602524) has the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-[2-amino-5-[(2-fluoro-3-pyridinyl)methoxy]phenyl]-2-methyliminoacetic acid.
| Compound Name | 2-[2-amino-5-[(2-fluoro-3-pyridinyl)methoxy]phenyl]-2-methyliminoacetic acid |
|---|---|
| PubChem CID | 170602524 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[2-amino-5-[(2-fluoro-3-pyridinyl)methoxy]phenyl]-2-methyliminoacetic acid |
| SMILES | C/N=C(\C(=O)O)c1cc(OCc2cccnc2F)ccc1N |
| InChI | InChI=1S/C15H14FN3O3/c1-18-13(15(20)21)11-7-10(4-5-12(11)17)22-8-9-3-2-6-19-14(9)16/h2-7H,8,17H2,1H3,(H,20,21)/b18-13- |
| InChIKey | FAHILVQXPGJMTB-AQTBWJFISA-N |
| XLogP | 1.89 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|