C21H27N5O2 — CID 170416750
2-[2-amino-5-(pyridin-2-ylmethoxy)phenyl]-2-methylimino-N-(1-methylpiperidin-4-yl)acetamide (PubChem CID 170416750) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[2-amino-5-(pyridin-2-ylmethoxy)phenyl]-2-methylimino-N-(1-methylpiperidin-4-yl)acetamide.
| Compound Name | 2-[2-amino-5-(pyridin-2-ylmethoxy)phenyl]-2-methylimino-N-(1-methylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 170416750 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-[2-amino-5-(pyridin-2-ylmethoxy)phenyl]-2-methylimino-N-(1-methylpiperidin-4-yl)acetamide |
| SMILES | C/N=C(\C(=O)NC1CCN(C)CC1)c1cc(OCc2ccccn2)ccc1N |
| InChI | InChI=1S/C21H27N5O2/c1-23-20(21(27)25-15-8-11-26(2)12-9-15)18-13-17(6-7-19(18)22)28-14-16-5-3-4-10-24-16/h3-7,10,13,15H,8-9,11-12,14,22H2,1-2H3,(H,25,27)/b23-20- |
| InChIKey | KFHPUFWMLGXCJK-ATJXCDBQSA-N |
| XLogP | 1.87 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|