C19H25N5O2S — CID 170416741
2-[2-amino-5-[(4-methyl-1,3-thiazol-5-yl)methoxy]phenyl]-2-methylimino-N-(1-methylpyrrolidin-3-yl)acetamide (PubChem CID 170416741) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-[2-amino-5-[(4-methyl-1,3-thiazol-5-yl)methoxy]phenyl]-2-methylimino-N-(1-methylpyrrolidin-3-yl)acetamide.
| Compound Name | 2-[2-amino-5-[(4-methyl-1,3-thiazol-5-yl)methoxy]phenyl]-2-methylimino-N-(1-methylpyrrolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 170416741 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-[2-amino-5-[(4-methyl-1,3-thiazol-5-yl)methoxy]phenyl]-2-methylimino-N-(1-methylpyrrolidin-3-yl)acetamide |
| SMILES | C/N=C(\C(=O)NC1CCN(C)C1)c1cc(OCc2scnc2C)ccc1N |
| InChI | InChI=1S/C19H25N5O2S/c1-12-17(27-11-22-12)10-26-14-4-5-16(20)15(8-14)18(21-2)19(25)23-13-6-7-24(3)9-13/h4-5,8,11,13H,6-7,9-10,20H2,1-3H3,(H,23,25)/b21-18- |
| InChIKey | LBHLJOVGTNFZOK-UZYVYHOESA-N |
| XLogP | 1.85 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|